Propylene Glycol n-Propyl Ether

Propylene Glycol n-Propyl Ether


Propylene Glycol n-Propyl Ether (PnP) is a colorless liquid with an ether-like odor. It evaporates quickly and is completely soluble (mixes easily) in water. PnP is a propylene oxide-based, or Pseries, glycol ether. PnP is commercially available as a mix of two isomers. 1-Propoxy-2-propanol is the major isomer comprising at least 95% of the mixture, while 2-n-propoxy-1-propanol makes
up the remaining 5%.


Substance name:Propylene glycol N-propyl ether
Trade name:Propylene glycol N-propyl ether
EC no:250-069-8
CAS no:1569-01-3
HS code:29094900
Formula:CH3CH2CH2OCH2CH(OH)CH3
Synonyms:Propylene Glycol n-Propyl Ether; Propylene glycol propyl ether; propyl propasol; 1-Propoxy-2-propanol; Propasol solvent P; 1-propoxy-2-propanol;)

Ek Bilgi Alın

hakkında ek bilgi için Propylene Glycol n-Propyl Ether lütfen telefon/e-posta yoluyla bizimle iletişime geçin
Adres: Fayzli Caddesi, Zangiota Bölgesi, Taşkent
E-mail: tashkent@fskimyo.uz
Tel. numarasi: +998 93 544 72 04
Veb sitesi: www.fskimyo.uz